5-METHOXY-PYRIDIN-3-OL
Catalog No: FT-0648342
CAS No: 109345-94-0
- Chemical Name: 5-METHOXY-PYRIDIN-3-OL
- Molecular Formula: C6H7NO2
- Molecular Weight: 125.13
- InChI Key: BREMJULVLYFLTE-UHFFFAOYSA-N
- InChI: InChI=1S/C6H7NO2/c1-9-6-2-5(8)3-7-4-6/h2-4,8H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 125.125 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 109345-94-0 |
| Bolling_Point: | 346.7±22.0 °C at 760 mmHg |
| Product_Name: | 5-Methoxy-3-pyridinol |
| Melting_Point: | N/A |
| Flash_Point: | 163.5±22.3 °C |
| MF: | C6H7NO2 |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 1.11 |
| Flash_Point: | 163.5±22.3 °C |
| Refractive_Index: | 1.539 |
| FW: | 125.125 |
| PSA: | 42.35000 |
| MF: | C6H7NO2 |
| Bolling_Point: | 346.7±22.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Exact_Mass: | 125.047676 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H315-H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)